CAS 879554-48-0 appears in our catalog under these names: O-Demethyl Tribenuron-methyl, 2-(((((1,4-Dihydro-6-methyl-4-oxo-1,3,5-triazin-2-yl)methylamino)carbonyl)amino)sulfonyl)benzoic Acid Methyl Ester, Tribenuron-methyl Metabolite IN-GK521, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 250mg, 1x1ml.
Methyl 2-[[methyl-(2-methyl-6-oxo-1H-1,3,5-triazin-4-yl)carbamoyl]sulfamoyl]benzoate (CAS 879554-48-0) is a chemical compound with the molecular formula C14H15N5O6S and a molecular weight of 381.37 g/mol. IUPAC name: methyl 2-[[methyl-(2-methyl-6-oxo-1H-1,3,5-triazin-4-yl)carbamoyl]sulfamoyl]benzoate. InChIKey: CIGKBGRGKJBGEA-UHFFFAOYSA-N.
| Molecular formula | C14H15N5O6S |
|---|---|
| Molecular weight | 381.37 g/mol |
| IUPAC name | methyl 2-[[methyl-(2-methyl-6-oxo-1H-1,3,5-triazin-4-yl)carbamoyl]sulfamoyl]benzoate |
| InChIKey | CIGKBGRGKJBGEA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=O)N1)N(C)C(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC |
Computed by PubChem (NCBI)