Triethylhexylammonium bromide, 98%
cas: 13028-71-2 — see every product listed under this CAS number, including other names
Triethylhexylammonium bromide, 98% (CAS 13028-71-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A347883-1g |
| cas | 13028-71-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 10g | 515.00 Pln | |
| Ambeed | 25g | 1049.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 448.40 Pln | |
| Chemat | 25g | 842.00 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 364.34 Pln | |
| BLDpharm | 10g | 547.61 Pln | |
| BLDpharm | 25g | 1125.18 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Triethyl(hexyl)azanium bromide (CAS 13028-71-2) is a chemical compound with the molecular formula C12H28BrN and a molecular weight of 266.26 g/mol. IUPAC name: triethyl(hexyl)azanium bromide. InChIKey: NAWZSHBMUXXTGV-UHFFFAOYSA-M.
| Molecular formula | C12H28BrN |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | triethyl(hexyl)azanium bromide |
| InChIKey | NAWZSHBMUXXTGV-UHFFFAOYSA-M |
| SMILES | CCCCCC[N+](CC)(CC)CC.[Br-] |
Computed by PubChem (NCBI)
