Products 284474-84-6
CAS 284474-84-6 appears in our catalog under these names: Tetra-n-propyl-d28-ammonium Bromide, 98 atom % D, min 98% Chemical Purity, TPABr-d28. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 10 mg, 5 mg, 1 mg.
Tetrakis(1,1,2,2,3,3,3-heptadeuteriopropyl)azanium bromide (CAS 284474-84-6) is a chemical compound with the molecular formula C12H28BrN and a molecular weight of 294.43 g/mol. IUPAC name: tetrakis(1,1,2,2,3,3,3-heptadeuteriopropyl)azanium bromide. InChIKey: BGQMOFGZRJUORO-PJUGJBFXSA-M.
| Molecular formula | C12H28BrN |
|---|---|
| Molecular weight | 294.43 g/mol |
| IUPAC name | tetrakis(1,1,2,2,3,3,3-heptadeuteriopropyl)azanium bromide |
| InChIKey | BGQMOFGZRJUORO-PJUGJBFXSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])[N+](C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])(C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H].[Br-] |
Computed by PubChem (NCBI)