CAS 287476-16-8 appears in our catalog under these names: Tetra-n-propylammonium-15N Bromide, 99 atom % 15N, min 98% Chemical Purity, TPABr-15N, 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 25 mg, 50 mg, 100 mg.
Tetrapropyl(15N)azanium bromide (CAS 287476-16-8) is a chemical compound with the molecular formula C12H28BrN and a molecular weight of 267.25 g/mol. IUPAC name: tetrapropyl(15N)azanium bromide. InChIKey: BGQMOFGZRJUORO-IDBRGDLFSA-M.
| Molecular formula | C12H28BrN |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | tetrapropyl(15N)azanium bromide |
| InChIKey | BGQMOFGZRJUORO-IDBRGDLFSA-M |
| SMILES | CCC[15N+](CCC)(CCC)CCC.[Br-] |
Computed by PubChem (NCBI)