CAS 117-89-5 appears in our catalog under these names: Trifluoperazine, Trifluoperazine/ 99.03% (existing batch purity), Trifluoperazine, 98%, 98%, Trifluoperazine, 99.87%, 10H-Phenothiazine, 10-[3-(4-methyl-1-piperazinyl)propyl]-2-(trifluoromethyl)-, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine (CAS 117-89-5) is a chemical compound with the molecular formula C21H24F3N3S and a molecular weight of 407.5 g/mol. IUPAC name: 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine. InChIKey: ZEWQUBUPAILYHI-UHFFFAOYSA-N.
| Molecular formula | C21H24F3N3S |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
| InChIKey | ZEWQUBUPAILYHI-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)