cas: 2459-10-1 — see every product listed under this CAS number, including other names
Trimethyl1,2,4-Benzenetricarboxylate, 98%, 98% (CAS 2459-10-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OOL-5g |
| cas | 2459-10-1 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 362.00 Pln | |
| Chemat | 500g | 1012.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trimethyl benzene-1,2,4-tricarboxylate (CAS 2459-10-1) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: trimethyl benzene-1,2,4-tricarboxylate. InChIKey: MJHNUUNSCNRGJE-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | trimethyl benzene-1,2,4-tricarboxylate |
| InChIKey | MJHNUUNSCNRGJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)