cas: 437-13-8 — see every product listed under this CAS number, including other names
Triphenylsulfonium Tetrafluoroborate, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 437-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114V70-100mg |
| cas | 437-13-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 818.00 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Triphenylsulfanium tetrafluoroborate (CAS 437-13-8) is a chemical compound with the molecular formula C18H15BF4S and a molecular weight of 350.2 g/mol. IUPAC name: triphenylsulfanium tetrafluoroborate. InChIKey: RTWMEMGVYYTCOZ-UHFFFAOYSA-N.
| Molecular formula | C18H15BF4S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | triphenylsulfanium tetrafluoroborate |
| InChIKey | RTWMEMGVYYTCOZ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)