Products 170950-29-5
CAS 170950-29-5 appears in our catalog under these names: TrxR1-IN-B19/ 99.61% (existing batch purity), TrxR1-IN-B19. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
(1E,4E)-1,5-bis(2,3-dimethoxyphenyl)penta-1,4-dien-3-one (CAS 170950-29-5) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: (1E,4E)-1,5-bis(2,3-dimethoxyphenyl)penta-1,4-dien-3-one. InChIKey: LSNRKPCFLXRJGN-PHEQNACWSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (1E,4E)-1,5-bis(2,3-dimethoxyphenyl)penta-1,4-dien-3-one |
| InChIKey | LSNRKPCFLXRJGN-PHEQNACWSA-N |
| SMILES | COC1=CC=CC(=C1OC)/C=C/C(=O)/C=C/C2=C(C(=CC=C2)OC)OC |
Computed by PubChem (NCBI)