CAS 152273-12-6 appears in our catalog under these names: U93631/ 99.97% (existing batch purity), U 93631, U93631, U93631 99%, U 93631, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg, 100 mg.
Tert-butyl 4,4-dimethyl-5H-imidazo[1,5-a]quinoxaline-3-carboxylate (CAS 152273-12-6) is a chemical compound with the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. IUPAC name: tert-butyl 4,4-dimethyl-5H-imidazo[1,5-a]quinoxaline-3-carboxylate. InChIKey: NXBSEJKZKXIYMD-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O2 |
|---|---|
| Molecular weight | 299.37 g/mol |
| IUPAC name | tert-butyl 4,4-dimethyl-5H-imidazo[1,5-a]quinoxaline-3-carboxylate |
| InChIKey | NXBSEJKZKXIYMD-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(N=CN2C3=CC=CC=C3N1)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)