CAS 2260826-16-0 appears in our catalog under these names: USP15-IN-1/ 99.81% (existing batch purity), USP15–IN–1, USP15-IN-1, USP15-IN-1, 99.68%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
N-(2-hydroxyethyl)-2-(2-phenylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide (CAS 2260826-16-0) is a chemical compound with the molecular formula C22H23N3O3 and a molecular weight of 377.4 g/mol. IUPAC name: N-(2-hydroxyethyl)-2-(2-phenylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide. InChIKey: GVWIQMYLHREBIR-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | N-(2-hydroxyethyl)-2-(2-phenylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| InChIKey | GVWIQMYLHREBIR-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C3=C(N2)C=CC(=C3)C(=O)NCCO)C(=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)