Uric acid sodium 95%
cas: 1198-77-2 — see every product listed under this CAS number, including other names
Uric acid sodium 95% (CAS 1198-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A855239-100g |
| cas | 1198-77-2 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3974.88 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 403.75 Pln | |
| Ambeed | 25g | 1288.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A855239 |
Sodium 2,6-dioxo-3,7-dihydropurin-8-olate (CAS 1198-77-2) is a chemical compound with the molecular formula C5H3N4NaO3 and a molecular weight of 190.09 g/mol. IUPAC name: sodium 2,6-dioxo-3,7-dihydropurin-8-olate. InChIKey: NAFSTSRULRIERK-UHFFFAOYSA-M.
| Molecular formula | C5H3N4NaO3 |
|---|---|
| Molecular weight | 190.09 g/mol |
| IUPAC name | sodium 2,6-dioxo-3,7-dihydropurin-8-olate |
| InChIKey | NAFSTSRULRIERK-UHFFFAOYSA-M |
| SMILES | C12=C(NC(=O)NC1=O)N=C(N2)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Uric acid sodium salt, Monosodium urate, SODIUM URATE, Uric acid, monosodium salt, 7,9-Dihydro-1H-purine-2,6,8(3H)-trione sodium salt, 1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, sodium salt, 1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, monosodium salt, Uric acid sodium, Uric acid (sodium), Dinatriumurat