CAS 1018830-99-3 appears in our catalog under these names: (2-AMINO-4-(3-(TRIFLUOROMETHYL)PHENYL)THIOPHEN-3-YL)(PHENYL)METHANONE, 95%, VPC171/ 99.52% (existing batch purity), VCP171, VCP 171, VCP171 95%. Offered by: Fluorochem, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
[2-amino-4-[3-(trifluoromethyl)phenyl]thiophen-3-yl]-phenylmethanone (CAS 1018830-99-3) is a chemical compound with the molecular formula C18H12F3NOS and a molecular weight of 347.4 g/mol. IUPAC name: [2-amino-4-[3-(trifluoromethyl)phenyl]thiophen-3-yl]-phenylmethanone. InChIKey: HNHLVOBHWXLIGP-UHFFFAOYSA-N.
| Molecular formula | C18H12F3NOS |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | [2-amino-4-[3-(trifluoromethyl)phenyl]thiophen-3-yl]-phenylmethanone |
| InChIKey | HNHLVOBHWXLIGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(SC=C2C3=CC(=CC=C3)C(F)(F)F)N |
Computed by PubChem (NCBI)