CAS 890764-36-0 appears in our catalog under these names: VU-29/ 99.47% (existing batch purity), VU 29, VU-29 99%, N-(1,3-Diphenyl-1H-pyrazol-5-yl)-4-nitrobenzamide, 97%, 97%, VU-29, 99.63%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
N-(1,3-diphenylpyrazol-5-yl)-4-nitrobenzamide (CAS 890764-36-0) is a chemical compound with the molecular formula C22H16N4O3 and a molecular weight of 384.4 g/mol. IUPAC name: N-(1,3-diphenylpyrazol-5-yl)-4-nitrobenzamide. InChIKey: KIALCSMRIHRFPL-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O3 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | N-(1,3-diphenylpyrazol-5-yl)-4-nitrobenzamide |
| InChIKey | KIALCSMRIHRFPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=C2)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)