CAS 409351-28-6 appears in our catalog under these names: VU0152100/ 99.43% (existing batch purity), VU0152100, VU 152100, VU0152100, 98+%, 98+%, VU0152100, 98.98%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
3-amino-N-[(4-methoxyphenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CAS 409351-28-6) is a chemical compound with the molecular formula C18H19N3O2S and a molecular weight of 341.4 g/mol. IUPAC name: 3-amino-N-[(4-methoxyphenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide. InChIKey: MDNWGCQSCGNTKH-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O2S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 3-amino-N-[(4-methoxyphenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| InChIKey | MDNWGCQSCGNTKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)NCC3=CC=C(C=C3)OC)N)C |
Computed by PubChem (NCBI)