Verdiperstat, 98+%
cas: 890655-80-8 — see every product listed under this CAS number, including other names
Verdiperstat, 98+% (CAS 890655-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1001768-100mg |
| cas | 890655-80-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2790.06 Pln | |
| Chemat | 1mg | 227.60 Pln | |
| Chemat | 5mg | 472.40 Pln | |
| Chemat | 10mg | 722.00 Pln | |
| Chemat | 25mg | 1605.20 Pln | |
| Chemat | 50mg | 2013.20 Pln | |
| Fluorochem | 50mg | 3725.79 Pln | |
| Fluorochem | 1mg | 398.84 Pln | |
| Fluorochem | 5mg | 857.01 Pln | |
| Fluorochem | 10mg | 1330.80 Pln | |
| Fluorochem | 25mg | 2986.47 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one (CAS 890655-80-8) is a chemical compound with the molecular formula C11H15N3O2S and a molecular weight of 253.32 g/mol. IUPAC name: 1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one. InChIKey: FVJCUZCRPIMVLB-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O2S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | FVJCUZCRPIMVLB-UHFFFAOYSA-N |
| SMILES | CC(C)OCCN1C2=C(C(=O)NC1=S)NC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Verdiperstat, 1-(2-Isopropoxyethyl)-2-thioxo-1,2,3,5-tetrahydropyrrolo(3,2-d)pyrimidin-4-one, verdiperstatum, 1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5H-pyrrolo(2,3-e)pyrimidin-4-one, 1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5H-pyrrolo[2,3-e]pyrimidin-4-one, Verdiperstat [USAN], Verdiperstat (AZD3241), 1-(2-Isopropoxyethyl)-2-thioxo-2,3-dihydro-1H-pyrrolo[3,2-d]pyrimidin-4(5H)-one, 1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one, 1-(2-Isopropoxyethyl)-2-thioxo-1,2,3,5-tetrahydro-pyrrolo[3,2-d]pyrimidin-4-one