Products 1223035-58-2
CAS 1223035-58-2 is the registry number for N-(4,5-Dimethylthiazol-2-yl)-6-oxopiperidine-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-oxopiperidine-3-carboxamide (CAS 1223035-58-2) is a chemical compound with the molecular formula C11H15N3O2S and a molecular weight of 253.32 g/mol. IUPAC name: N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-oxopiperidine-3-carboxamide. InChIKey: AVJCXNLUQQKHDQ-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O2S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-oxopiperidine-3-carboxamide |
| InChIKey | AVJCXNLUQQKHDQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C2CCC(=O)NC2)C |
Computed by PubChem (NCBI)