CAS 1154384-39-0 is the registry number for 4-(1,1-Dioxidothiomorpholino)benzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,1-dioxo-1,4-thiazinan-4-yl)benzenecarboximidamide (CAS 1154384-39-0) is a chemical compound with the molecular formula C11H15N3O2S and a molecular weight of 253.32 g/mol. IUPAC name: 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzenecarboximidamide. InChIKey: KZHUAIDLVJZQGP-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O2S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzenecarboximidamide |
| InChIKey | KZHUAIDLVJZQGP-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=C(C=C2)C(=N)N |
Computed by PubChem (NCBI)