cas: 748810-28-8 — see every product listed under this CAS number, including other names
Vernakalant HCl 99% (CAS 748810-28-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A161054-1mg |
| cas | 748810-28-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 170.12 Pln | |
| Ambeed | 5mg | 248.00 Pln | |
| Ambeed | 10mg | 314.75 Pln | |
| Ambeed | 25mg | 487.19 Pln | |
| Ambeed | 50mg | 770.88 Pln | |
| Ambeed | 100mg | 1271.50 Pln | |
| Ambeed | 250mg | 2094.75 Pln | |
| Ambeed | 1g | 7345.75 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A161054 |
(3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride (CAS 748810-28-8) is a chemical compound with the molecular formula C20H32ClNO4 and a molecular weight of 385.9 g/mol. IUPAC name: (3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride. InChIKey: JMHYCBFEEFHTMK-IIUXMCBISA-N.
| Molecular formula | C20H32ClNO4 |
|---|---|
| Molecular weight | 385.9 g/mol |
| IUPAC name | (3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride |
| InChIKey | JMHYCBFEEFHTMK-IIUXMCBISA-N |
| SMILES | COC1=C(C=C(C=C1)CCO[C@@H]2CCCC[C@H]2N3CC[C@H](C3)O)OC.Cl |
Computed by PubChem (NCBI)