cas: 53839-71-7 — see every product listed under this CAS number, including other names
Viaminate 95% (CAS 53839-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1496164-100mg |
| cas | 53839-71-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 520.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1496164 |
Ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate (CAS 53839-71-7) is a chemical compound with the molecular formula C29H37NO3 and a molecular weight of 447.6 g/mol. IUPAC name: ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate. InChIKey: VRSMJNVXOITYPE-FSDIUQKZSA-N.
| Molecular formula | C29H37NO3 |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate |
| InChIKey | VRSMJNVXOITYPE-FSDIUQKZSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(CCCC2(C)C)C |
Computed by PubChem (NCBI)