CAS 1913291-02-7 appears in our catalog under these names: WRG-28, 98%, WRG-28/ 97.84% (existing batch purity), WRG–28, WRG-28, WRG-28, 97.84% ,, 97.84% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
N-ethyl-4-[(7-oxophenoxazin-3-yl)oxymethyl]benzenesulfonamide (CAS 1913291-02-7) is a chemical compound with the molecular formula C21H18N2O5S and a molecular weight of 410.4 g/mol. IUPAC name: N-ethyl-4-[(7-oxophenoxazin-3-yl)oxymethyl]benzenesulfonamide. InChIKey: AARVTLIQNGAELZ-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O5S |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | N-ethyl-4-[(7-oxophenoxazin-3-yl)oxymethyl]benzenesulfonamide |
| InChIKey | AARVTLIQNGAELZ-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC=C(C=C1)COC2=CC3=C(C=C2)N=C4C=CC(=O)C=C4O3 |
Computed by PubChem (NCBI)