cas: 521-45-9 — see every product listed under this CAS number, including other names
Wushanicaritin 98% (CAS 521-45-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1364774-1mg |
| cas | 521-45-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 186.81 Pln | |
| Ambeed | 5mg | 298.06 Pln | |
| Ambeed | 10mg | 453.81 Pln | |
| Ambeed | 25mg | 759.75 Pln | |
| Ambeed | 50mg | 1182.50 Pln | |
| Ambeed | 100mg | 1727.62 Pln | |
| Ambeed | 250mg | 2061.38 Pln | |
| Ambeed | 1g | 4102.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1364774 |
3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one (CAS 521-45-9) is a chemical compound with the molecular formula C21H22O7 and a molecular weight of 386.4 g/mol. IUPAC name: 3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one. InChIKey: VAYWXTLNNGACLF-UHFFFAOYSA-N.
| Molecular formula | C21H22O7 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | VAYWXTLNNGACLF-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC=C(C=C3)OC)O)O |
Computed by PubChem (NCBI)