CAS 521-45-9 appears in our catalog under these names: Icariin Impurity 4, Wushanicaritin, Wushanicaritin 98%, Wushanicaritin, 98%, 98%, Wushanicaritin, 98.54%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one (CAS 521-45-9) is a chemical compound with the molecular formula C21H22O7 and a molecular weight of 386.4 g/mol. IUPAC name: 3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one. InChIKey: VAYWXTLNNGACLF-UHFFFAOYSA-N.
| Molecular formula | C21H22O7 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | VAYWXTLNNGACLF-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC=C(C=C3)OC)O)O |
Computed by PubChem (NCBI)