Products 31702-79-1
CAS 31702-79-1 is the registry number for Fenofibrate Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[4-(2-carboxypropan-2-yloxy)benzoyl]phenoxy]-2-methylpropanoic acid (CAS 31702-79-1) is a chemical compound with the molecular formula C21H22O7 and a molecular weight of 386.4 g/mol. IUPAC name: 2-[4-[4-(2-carboxypropan-2-yloxy)benzoyl]phenoxy]-2-methylpropanoic acid. InChIKey: GEXUOQIZZHTPMB-UHFFFAOYSA-N.
| Molecular formula | C21H22O7 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 2-[4-[4-(2-carboxypropan-2-yloxy)benzoyl]phenoxy]-2-methylpropanoic acid |
| InChIKey | GEXUOQIZZHTPMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OC(C)(C)C(=O)O |
Computed by PubChem (NCBI)