cas: 748778-73-6 — see every product listed under this CAS number, including other names
YC-001 99% (CAS 748778-73-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1062054-50mg |
| cas | 748778-73-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 570.62 Pln | |
| Ambeed | 100mg | 921.06 Pln | |
| Ambeed | 250mg | 1683.12 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1062054 |
3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one (CAS 748778-73-6) is a chemical compound with the molecular formula C12H7ClO2S2 and a molecular weight of 282.8 g/mol. IUPAC name: 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one. InChIKey: RCLLWMPOHNZNAO-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO2S2 |
|---|---|
| Molecular weight | 282.8 g/mol |
| IUPAC name | 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one |
| InChIKey | RCLLWMPOHNZNAO-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)C2=CC=CS2)C3=CC=C(S3)Cl |
Computed by PubChem (NCBI)