cas: 66845-42-9 — see every product listed under this CAS number, including other names
Z-D-Lys(Boc)-OH, 97% (CAS 66845-42-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 250mg, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F318244-5G |
| cas | 66845-42-9 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1388.07 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 559.50 Pln | |
| Ambeed | 100g | 1705.38 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 66845-42-9) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: DYSBKEOCHROEGX-OAHLLOKOSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DYSBKEOCHROEGX-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)