cas: 66845-42-9 — see every product listed under this CAS number, including other names
Z-D-Lys(Boc)-OH, 97% (CAS 66845-42-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318244-10G |
| cas | 66845-42-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 372.80 Pln | |
| Fluorochem | 100g | 1320.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 66845-42-9) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: DYSBKEOCHROEGX-OAHLLOKOSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DYSBKEOCHROEGX-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)