cas: 70671-54-4 — see every product listed under this CAS number, including other names
Z-D-Lys-OH, 99.96% (CAS 70671-54-4) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 25 g, 500 mg, 100 g, 10 g, 5 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013297-1 g |
| cas | 70671-54-4 |
| size | 1 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 282.54 Pln | |
| MedChemExpress | 25 g | 1415.68 Pln | |
| MedChemExpress | 500 mg | 240.74 Pln | |
| MedChemExpress | 100 g | 3431.17 Pln | |
| MedChemExpress | 10 g | 765.52 Pln | |
| MedChemExpress | 5 g | 528.67 Pln | |
| MedChemExpress | 50 g | 2191.22 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.96% |
(2R)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 70671-54-4) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: (2R)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: OJTJKAUNOLVMDX-GFCCVEGCSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (2R)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | OJTJKAUNOLVMDX-GFCCVEGCSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)