CAS 197855-65-5 appears in our catalog under these names: Z–FA–FMK, Z-FA-FMK, Z-FA-FMK/ 99.43% (existing batch purity), Z-FA-FMK, 99%, 99%, Z-FA-FMK, 99.14%. Offered by: GLPBio, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 25mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 1 mg.
Benzyl N-[(2S)-1-[(4-fluoro-3-oxobutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 197855-65-5) is a chemical compound with the molecular formula C21H23FN2O4 and a molecular weight of 386.4 g/mol. IUPAC name: benzyl N-[(2S)-1-[(4-fluoro-3-oxobutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: ASXVEBPEZMSPHB-PKHIMPSTSA-N.
| Molecular formula | C21H23FN2O4 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[(4-fluoro-3-oxobutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | ASXVEBPEZMSPHB-PKHIMPSTSA-N |
| SMILES | CC(C(=O)CF)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)