CAS 2803-63-6 appears in our catalog under these names: Z26395438/ 99.63% (existing batch purity), Z26395438, Z26395438, 99.59%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzamide (CAS 2803-63-6) is a chemical compound with the molecular formula C17H15FN2O and a molecular weight of 282.31 g/mol. IUPAC name: 4-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzamide. InChIKey: RIQRTTNBTVNSSP-UHFFFAOYSA-N.
| Molecular formula | C17H15FN2O |
|---|---|
| Molecular weight | 282.31 g/mol |
| IUPAC name | 4-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzamide |
| InChIKey | RIQRTTNBTVNSSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)