CAS 1005883-72-6 appears in our catalog under these names: Z433927330/ 99.78% (existing batch purity), Z433927330, Z433927330 98+%, Ethyl 4-(3-(4-(1H-pyrazol-1-yl)benzyl)ureido)benzoate, 98+%, 98+%, Z433927330, 98.11%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
Ethyl 4-[(4-pyrazol-1-ylphenyl)methylcarbamoylamino]benzoate (CAS 1005883-72-6) is a chemical compound with the molecular formula C20H20N4O3 and a molecular weight of 364.4 g/mol. IUPAC name: ethyl 4-[(4-pyrazol-1-ylphenyl)methylcarbamoylamino]benzoate. InChIKey: KQUKHINHCUELQL-UHFFFAOYSA-N.
| Molecular formula | C20H20N4O3 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | ethyl 4-[(4-pyrazol-1-ylphenyl)methylcarbamoylamino]benzoate |
| InChIKey | KQUKHINHCUELQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)NCC2=CC=C(C=C2)N3C=CC=N3 |
Computed by PubChem (NCBI)