CAS 1090893-12-1 appears in our catalog under these names: Z62954982, Z62954982/ 98.28% (existing batch purity), Insolution rac1 inhibitor II, Z62954982, Z62954982 95%, Rac1 Inhibitor II 1PC X 10MG. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 1mg (99,87mM * 24,1μl in dmso), 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-methyl-3-sulfamoylphenyl)benzamide (CAS 1090893-12-1) is a chemical compound with the molecular formula C20H21N3O5S and a molecular weight of 415.5 g/mol. IUPAC name: 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-methyl-3-sulfamoylphenyl)benzamide. InChIKey: OZZQJOAJXMUXCO-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O5S |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-methyl-3-sulfamoylphenyl)benzamide |
| InChIKey | OZZQJOAJXMUXCO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)OCC3=C(ON=C3C)C)S(=O)(=O)N |
Computed by PubChem (NCBI)