CAS 1952264-36-6 appears in our catalog under these names: ZEN-3411/ 97.77% (existing batch purity), ZEN-3411. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[4-(oxiran-2-yl)phenyl]methyl]benzimidazol-4-amine (CAS 1952264-36-6) is a chemical compound with the molecular formula C21H20N4O2 and a molecular weight of 360.4 g/mol. IUPAC name: 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[4-(oxiran-2-yl)phenyl]methyl]benzimidazol-4-amine. InChIKey: XINQCOMOQIYWTG-UHFFFAOYSA-N.
| Molecular formula | C21H20N4O2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[4-(oxiran-2-yl)phenyl]methyl]benzimidazol-4-amine |
| InChIKey | XINQCOMOQIYWTG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=C3C(=C2)N(C=N3)CC4=CC=C(C=C4)C5CO5)N |
Computed by PubChem (NCBI)