cas: 83059-56-7 — see every product listed under this CAS number, including other names
Zabicipril (CAS 83059-56-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg. Offered by: Chemat, MedChemExpress.
| brand | Chemat |
|---|---|
| catalog number | Ch11G86P-1mg |
| cas | 83059-56-7 |
| size | 1mg |
| availability | 0.2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 616.40 Pln | |
| Chemat | 5mg | 1446.80 Pln | |
| Chemat | 10mg | 2037.20 Pln | |
| Chemat | 25mg | 2901.20 Pln | |
| Chemat | 50mg | 4043.60 Pln | |
| Chemat | 100mg | 5406.80 Pln | |
| Chemat | 200mg | 7149.20 Pln | |
| MedChemExpress | 5 mg | 6491.57 Pln | |
| MedChemExpress | 1 mg | 2706.71 Pln | |
| MedChemExpress | 10 mg | 9199.02 Pln |
| delivery time | 3 weeks |
|---|
(3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2-azabicyclo[2.2.2]octane-3-carboxylic acid (CAS 83059-56-7) is a chemical compound with the molecular formula C23H32N2O5 and a molecular weight of 416.5 g/mol. IUPAC name: (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2-azabicyclo[2.2.2]octane-3-carboxylic acid. InChIKey: OMGPCTGQLHHVDU-SSXGPBTGSA-N.
| Molecular formula | C23H32N2O5 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2-azabicyclo[2.2.2]octane-3-carboxylic acid |
| InChIKey | OMGPCTGQLHHVDU-SSXGPBTGSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2[C@@H](C3CCC2CC3)C(=O)O |
Computed by PubChem (NCBI)