CAS 83059-56-7 appears in our catalog under these names: Zabicipril/ 98.31% (existing batch purity), Zabicipril. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
(3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2-azabicyclo[2.2.2]octane-3-carboxylic acid (CAS 83059-56-7) is a chemical compound with the molecular formula C23H32N2O5 and a molecular weight of 416.5 g/mol. IUPAC name: (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2-azabicyclo[2.2.2]octane-3-carboxylic acid. InChIKey: OMGPCTGQLHHVDU-SSXGPBTGSA-N.
| Molecular formula | C23H32N2O5 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2-azabicyclo[2.2.2]octane-3-carboxylic acid |
| InChIKey | OMGPCTGQLHHVDU-SSXGPBTGSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2[C@@H](C3CCC2CC3)C(=O)O |
Computed by PubChem (NCBI)