cas: 17949-65-4 — see every product listed under this CAS number, including other names
Zinc picolinate, 97.0% (CAS 17949-65-4) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g, 10 g, 50 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W459577-25 g |
| cas | 17949-65-4 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 361.49 Pln | |
| MedChemExpress | 100 g | 695.86 Pln | |
| MedChemExpress | 10 g | 240.74 Pln | |
| MedChemExpress | 50 g | 477.59 Pln | |
| MedChemExpress | 500 g | 1536.42 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
Zinc bis(pyridine-2-carboxylate) (CAS 17949-65-4) is a chemical compound with the molecular formula C12H8N2O4Zn and a molecular weight of 309.6 g/mol. IUPAC name: zinc bis(pyridine-2-carboxylate). InChIKey: NHVUUBRKFZWXRN-UHFFFAOYSA-L.
| Molecular formula | C12H8N2O4Zn |
|---|---|
| Molecular weight | 309.6 g/mol |
| IUPAC name | zinc bis(pyridine-2-carboxylate) |
| InChIKey | NHVUUBRKFZWXRN-UHFFFAOYSA-L |
| SMILES | C1=CC=NC(=C1)C(=O)[O-].C1=CC=NC(=C1)C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)