cas: 17949-65-4 — see every product listed under this CAS number, including other names
Zincpicolinate, 97%, 97% (CAS 17949-65-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113824-5g |
| cas | 17949-65-4 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 342.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Zinc bis(pyridine-2-carboxylate) (CAS 17949-65-4) is a chemical compound with the molecular formula C12H8N2O4Zn and a molecular weight of 309.6 g/mol. IUPAC name: zinc bis(pyridine-2-carboxylate). InChIKey: NHVUUBRKFZWXRN-UHFFFAOYSA-L.
| Molecular formula | C12H8N2O4Zn |
|---|---|
| Molecular weight | 309.6 g/mol |
| IUPAC name | zinc bis(pyridine-2-carboxylate) |
| InChIKey | NHVUUBRKFZWXRN-UHFFFAOYSA-L |
| SMILES | C1=CC=NC(=C1)C(=O)[O-].C1=CC=NC(=C1)C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)