CAS 959605-90-4 appears in our catalog under these names: Zolpidem-d6 (100ug/ml in Methanol), Zolpidem-d6, Zolpidem-D6 0.1 mg/ml in Methanol. Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 5x1ml, 10mg, 1mg, 1ml, 5mg, 25mg, 50mg.
2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-bis(trideuteriomethyl)acetamide (CAS 959605-90-4) is a chemical compound with the molecular formula C19H21N3O and a molecular weight of 313.4 g/mol. IUPAC name: 2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-bis(trideuteriomethyl)acetamide. InChIKey: ZAFYATHCZYHLPB-LIJFRPJRSA-N.
| Molecular formula | C19H21N3O |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-bis(trideuteriomethyl)acetamide |
| InChIKey | ZAFYATHCZYHLPB-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)CC1=C(N=C2N1C=C(C=C2)C)C3=CC=C(C=C3)C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)