CAS 51022-73-2 appears in our catalog under these names: Zometapine/ 99.7% (existing batch purity), Zometapine. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 50 mg, 5 mg, 25 mg.
4-(3-chlorophenyl)-1,3-dimethyl-7,8-dihydro-6H-pyrazolo[5,4-e][1,4]diazepine (CAS 51022-73-2) is a chemical compound with the molecular formula C14H15ClN4 and a molecular weight of 274.75 g/mol. IUPAC name: 4-(3-chlorophenyl)-1,3-dimethyl-7,8-dihydro-6H-pyrazolo[5,4-e][1,4]diazepine. InChIKey: YCWROMXNZZIJDQ-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN4 |
|---|---|
| Molecular weight | 274.75 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-1,3-dimethyl-7,8-dihydro-6H-pyrazolo[5,4-e][1,4]diazepine |
| InChIKey | YCWROMXNZZIJDQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=NCCN2)C3=CC(=CC=C3)Cl)C |
Computed by PubChem (NCBI)