cas: 43200-81-3 — see every product listed under this CAS number, including other names
Zopiclone impurity B 95% (CAS 43200-81-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202482-250mg |
| cas | 43200-81-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 10g | 915.50 Pln | |
| Ambeed | 25g | 1360.50 Pln | |
| Ambeed | 100g | 4992.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A202482 |
6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one (CAS 43200-81-3) is a chemical compound with the molecular formula C11H7ClN4O2 and a molecular weight of 262.65 g/mol. IUPAC name: 6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one. InChIKey: FUUXOEKDNNWZTR-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4O2 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | 6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one |
| InChIKey | FUUXOEKDNNWZTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)N2C(C3=NC=CN=C3C2=O)O |
Computed by PubChem (NCBI)