CAS 1400787-78-1 is the registry number for Zopiclone Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
(7S)-6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one (CAS 1400787-78-1) is a chemical compound with the molecular formula C11H7ClN4O2 and a molecular weight of 262.65 g/mol. IUPAC name: (7S)-6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one. InChIKey: FUUXOEKDNNWZTR-JTQLQIEISA-N.
| Molecular formula | C11H7ClN4O2 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | (7S)-6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one |
| InChIKey | FUUXOEKDNNWZTR-JTQLQIEISA-N |
| SMILES | C1=CC(=NC=C1Cl)N2[C@H](C3=NC=CN=C3C2=O)O |
Computed by PubChem (NCBI)