CAS 43200-81-3 appears in our catalog under these names: Zopiclone EP Impurity B, Zopiclone Impurity 2 (Zopiclone EP Impurity B), 6-(5-Chloro-2-pyridyl)-6,7-dihydro-7-hydroxy-5H-pyrrolo(3,4-b)pyrazin-5-one, >95% (HPLC), (7RS)-6-(5-Chloropyridin-2-yl)-7-hydroxy-6,7-dihydro-5H-pyrrolo(3,4-b)pyrazin-5-one, 6–(5–Chloro–2–pyridyl)–6,7–dihydro–7–hydroxy–5H–pyrrolo(3,4–b)pyrazin–5–one. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 250mg.
6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one (CAS 43200-81-3) is a chemical compound with the molecular formula C11H7ClN4O2 and a molecular weight of 262.65 g/mol. IUPAC name: 6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one. InChIKey: FUUXOEKDNNWZTR-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4O2 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | 6-(5-chloro-2-pyridinyl)-7-hydroxy-7H-pyrrolo[3,4-b]pyrazin-5-one |
| InChIKey | FUUXOEKDNNWZTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)N2C(C3=NC=CN=C3C2=O)O |
Computed by PubChem (NCBI)