cas: 36635-66-2 — see every product listed under this CAS number, including other names
a-Tosylbenzyl isocyanide 98% (CAS 36635-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A313896-100g |
| cas | 36635-66-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 17870.00 Pln | |
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1065.69 Pln | |
| Ambeed | 25g | 4520.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A313896 |
1-[isocyano(phenyl)methyl]sulfonyl-4-methylbenzene (CAS 36635-66-2) is a chemical compound with the molecular formula C15H13NO2S and a molecular weight of 271.3 g/mol. IUPAC name: 1-[isocyano(phenyl)methyl]sulfonyl-4-methylbenzene. InChIKey: KIJCBVOPJSHLBI-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2S |
|---|---|
| Molecular weight | 271.3 g/mol |
| IUPAC name | 1-[isocyano(phenyl)methyl]sulfonyl-4-methylbenzene |
| InChIKey | KIJCBVOPJSHLBI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=CC=C2)[N+]#[C-] |
Computed by PubChem (NCBI)