cas: 5691-20-3 — see every product listed under this CAS number, including other names
cis–2–Amino–1–cyclohexanecarboxylic acid (CAS 5691-20-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 500mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD08119-1g |
| cas | 5691-20-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 3812.54 Pln | |
| GLPBio | 250mg | 1425.49 Pln | |
| GLPBio | 500mg | 2221.17 Pln | |
| GLPBio | 50mg | 704.69 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid (CAS 5691-20-3) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid. InChIKey: USQHEVWOPJDAAX-RITPCOANSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid |
| InChIKey | USQHEVWOPJDAAX-RITPCOANSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)N |
Computed by PubChem (NCBI)