cas: 5691-20-3 — see every product listed under this CAS number, including other names
cis-2-Amino-1-cyclohexanecarboxylic acid, ≥95%, ≥95% (CAS 5691-20-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAX5-500mg |
| cas | 5691-20-3 |
| size | 500mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 2090.00 Pln | |
| Chemat | 1g | 3875.60 Pln | |
| Chemat | 50mg | 352.40 Pln | |
| Chemat | 250mg | 1197.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid (CAS 5691-20-3) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid. InChIKey: USQHEVWOPJDAAX-RITPCOANSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid |
| InChIKey | USQHEVWOPJDAAX-RITPCOANSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)N |
Computed by PubChem (NCBI)