cas: 132622-66-3 — see every product listed under this CAS number, including other names
cis-1-Boc-4-Amino-L-proline, 98% (CAS 132622-66-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048459-250MG |
| cas | 132622-66-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 669.57 Pln | |
| Fluorochem | 10g | 1283.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 132622-66-3) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (2S,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: WDWRIVZIPSHUOR-BQBZGAKWSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2S,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WDWRIVZIPSHUOR-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)N |
Computed by PubChem (NCBI)