cas: 1008773-79-2 — see every product listed under this CAS number, including other names
cis-3-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid, 99.62% (CAS 1008773-79-2) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 10 g, 1 g, 250 mg, 25 g, 100 g, 500 mg, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W041873-50 g |
| cas | 1008773-79-2 |
| size | 50 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 4429.63 Pln | |
| MedChemExpress | 10 g | 1155.61 Pln | |
| MedChemExpress | 1 g | 361.49 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 25 g | 2664.91 Pln | |
| MedChemExpress | 100 g | 7434.30 Pln | |
| MedChemExpress | 500 mg | 287.18 Pln | |
| MedChemExpress | 5 g | 742.30 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.62% |
3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 1008773-79-2) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: KLCYDBAYYYVNFM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | KLCYDBAYYYVNFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)C(=O)O |
Computed by PubChem (NCBI)