cas: 1008773-79-2 — see every product listed under this CAS number, including other names
cis-3-(tert-Butoxycarbonylamino)cyclobutanecarboxylic acid, 97%, 97% (CAS 1008773-79-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111446-10g |
| cas | 1008773-79-2 |
| size | 10g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 616.40 Pln | |
| Chemat | 500g | 21326.40 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 333.20 Pln | |
| Chemat | 25g | 1360.40 Pln | |
| Chemat | 100g | 5133.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 1008773-79-2) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: KLCYDBAYYYVNFM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | KLCYDBAYYYVNFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)C(=O)O |
Computed by PubChem (NCBI)