cis-3-Methoxycyclohexanecarboxylic acid, 97%
cas: 73873-52-6 — see every product listed under this CAS number, including other names
cis-3-Methoxycyclohexanecarboxylic acid, 97% (CAS 73873-52-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A500347-250mg |
| cas | 73873-52-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1577.44 Pln | |
| Ambeed | 5g | 5343.25 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1697.20 Pln | |
| BLDpharm | 5g | 5756.89 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1048.40 Pln | |
| Chemat | 5g | 4835.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Cis-(1R,3S)-3-methoxycyclohexane-1-carboxylic acid (CAS 73873-52-6) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: cis-(1R,3S)-3-methoxycyclohexane-1-carboxylic acid. InChIKey: KAWNRNMMEKTYGM-RQJHMYQMSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | cis-(1R,3S)-3-methoxycyclohexane-1-carboxylic acid |
| InChIKey | KAWNRNMMEKTYGM-RQJHMYQMSA-N |
| SMILES | CO[C@H]1CCC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
cis-3-Methoxycyclohexanecarboxylic acid, Cyclohexanecarboxylic acid, 3-methoxy-, (1R,3S)-rel-, (1R,3S)-3-methoxycyclohexane-1-carboxylic acid, cyclohexanecarboxylic acid,3-methoxy-,(1R,3S)-rel-, cis-3-Methoxycyclohexanecarboxylicacid, (1R,3S)-3-methoxycyclohexanecarboxylic acid, rel-(1R,3S)-3-Methoxycyclohexanecarboxylic acid