CAS 2231666-50-3 is the registry number for (1S,3S)-3-Methoxycyclohexane-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1S,3S)-3-methoxycyclohexane-1-carboxylic acid (CAS 2231666-50-3) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: trans-(1S,3S)-3-methoxycyclohexane-1-carboxylic acid. InChIKey: KAWNRNMMEKTYGM-BQBZGAKWSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | trans-(1S,3S)-3-methoxycyclohexane-1-carboxylic acid |
| InChIKey | KAWNRNMMEKTYGM-BQBZGAKWSA-N |
| SMILES | CO[C@H]1CCC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)