Products 73873-52-6
CAS 73873-52-6 is the registry number for cis-3-Methoxycyclohexanecarboxylic acid, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
Cis-(1R,3S)-3-methoxycyclohexane-1-carboxylic acid (CAS 73873-52-6) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: cis-(1R,3S)-3-methoxycyclohexane-1-carboxylic acid. InChIKey: KAWNRNMMEKTYGM-RQJHMYQMSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | cis-(1R,3S)-3-methoxycyclohexane-1-carboxylic acid |
| InChIKey | KAWNRNMMEKTYGM-RQJHMYQMSA-N |
| SMILES | CO[C@H]1CCC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
cis-3-Methoxycyclohexanecarboxylic acid, Cyclohexanecarboxylic acid, 3-methoxy-, (1R,3S)-rel-, (1R,3S)-3-methoxycyclohexane-1-carboxylic acid, cyclohexanecarboxylic acid,3-methoxy-,(1R,3S)-rel-, cis-3-Methoxycyclohexanecarboxylicacid, (1R,3S)-3-methoxycyclohexanecarboxylic acid, rel-(1R,3S)-3-Methoxycyclohexanecarboxylic acid