cas: 53292-90-3 — see every product listed under this CAS number, including other names
cis-4-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid 97% (CAS 53292-90-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A504120-500g |
| cas | 53292-90-3 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 11384.12 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 909.94 Pln | |
| Ambeed | 100g | 2895.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A504120 |
4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 53292-90-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: KXMRDHPZQHAXML-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | KXMRDHPZQHAXML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)